C13H16Cl6 — CID 10524118
(1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(2R)-3,3-dimethylbutan-2-yl]bicyclo[2.2.1]hept-2-ene (PubChem CID 10524118) has the molecular formula C13H16Cl6 and a molecular weight of 384.99 g/mol. Its IUPAC name is (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(2R)-3,3-dimethylbutan-2-yl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(2R)-3,3-dimethylbutan-2-yl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 10524118 |
| Molecular Formula | C13H16Cl6 |
| Molecular Weight | 384.99 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(2R)-3,3-dimethylbutan-2-yl]bicyclo[2.2.1]hept-2-ene |
| SMILES | C[C@H]([C@H]1C[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl)C(C)(C)C |
| InChI | InChI=1S/C13H16Cl6/c1-6(10(2,3)4)7-5-11(16)8(14)9(15)12(7,17)13(11,18)19/h6-7H,5H2,1-4H3/t6-,7-,11-,12+/m1/s1 |
| InChIKey | WVWKXMCBJWZQBX-ONAGUOBHSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.99 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|