C17H33N3 — CID 105241237
[1-(2-bicyclo[2.2.1]heptanyl)-3-methyl-3-pyrrolidin-1-ylpentan-2-yl]hydrazine (PubChem CID 105241237) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is [1-(2-bicyclo[2.2.1]heptanyl)-3-methyl-3-pyrrolidin-1-ylpentan-2-yl]hydrazine.
| Compound Name | [1-(2-bicyclo[2.2.1]heptanyl)-3-methyl-3-pyrrolidin-1-ylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105241237 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | [1-(2-bicyclo[2.2.1]heptanyl)-3-methyl-3-pyrrolidin-1-ylpentan-2-yl]hydrazine |
| SMILES | CCC(C)(C(CC1CC2CCC1C2)NN)N1CCCC1 |
| InChI | InChI=1S/C17H33N3/c1-3-17(2,20-8-4-5-9-20)16(19-18)12-15-11-13-6-7-14(15)10-13/h13-16,19H,3-12,18H2,1-2H3 |
| InChIKey | CQYMHPYKEPYYMA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|