C18H31N3 — CID 105242617
1-[(2,4-dimethylphenyl)-hydrazinylmethyl]-N,N-diethylcyclopentan-1-amine (PubChem CID 105242617) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)-hydrazinylmethyl]-N,N-diethylcyclopentan-1-amine.
| Compound Name | 1-[(2,4-dimethylphenyl)-hydrazinylmethyl]-N,N-diethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 105242617 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)-hydrazinylmethyl]-N,N-diethylcyclopentan-1-amine |
| SMILES | CCN(CC)C1(C(NN)c2ccc(C)cc2C)CCCC1 |
| InChI | InChI=1S/C18H31N3/c1-5-21(6-2)18(11-7-8-12-18)17(20-19)16-10-9-14(3)13-15(16)4/h9-10,13,17,20H,5-8,11-12,19H2,1-4H3 |
| InChIKey | UDNGPJQVEVIRCI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|