C18H29N3 — CID 105242928
[(2-methylphenyl)-(1-piperidin-1-ylcyclopentyl)methyl]hydrazine (PubChem CID 105242928) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is [(2-methylphenyl)-(1-piperidin-1-ylcyclopentyl)methyl]hydrazine.
| Compound Name | [(2-methylphenyl)-(1-piperidin-1-ylcyclopentyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105242928 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | [(2-methylphenyl)-(1-piperidin-1-ylcyclopentyl)methyl]hydrazine |
| SMILES | Cc1ccccc1C(NN)C1(N2CCCCC2)CCCC1 |
| InChI | InChI=1S/C18H29N3/c1-15-9-3-4-10-16(15)17(20-19)18(11-5-6-12-18)21-13-7-2-8-14-21/h3-4,9-10,17,20H,2,5-8,11-14,19H2,1H3 |
| InChIKey | ICUPGRNLUJDECB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|