C16H26ClN3 — CID 105243271
1-[2-(2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylcyclohexan-1-amine (PubChem CID 105243271) has the molecular formula C16H26ClN3 and a molecular weight of 295.86 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 1-[2-(2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 105243271 |
| Molecular Formula | C16H26ClN3 |
| Molecular Weight | 295.86 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-1-hydrazinylethyl]-N,N-dimethylcyclohexan-1-amine |
| SMILES | CN(C)C1(C(Cc2ccccc2Cl)NN)CCCCC1 |
| InChI | InChI=1S/C16H26ClN3/c1-20(2)16(10-6-3-7-11-16)15(19-18)12-13-8-4-5-9-14(13)17/h4-5,8-9,15,19H,3,6-7,10-12,18H2,1-2H3 |
| InChIKey | HFYOJHTXYMIDHV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|