C25H28N2O2 — CID 10524344
(1S,13R,14R)-24-ethyl-19-methoxy-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-20-ol (PubChem CID 10524344) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (1S,13R,14R)-24-ethyl-19-methoxy-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-20-ol.
| Compound Name | (1S,13R,14R)-24-ethyl-19-methoxy-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-20-ol |
|---|---|
| PubChem CID | 10524344 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (1S,13R,14R)-24-ethyl-19-methoxy-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-20-ol |
| SMILES | CCN1CC[C@]23Cc4[nH]c5ccccc5c4C[C@H]2[C@H]1Cc1ccc(OC)c(O)c13 |
| InChI | InChI=1S/C25H28N2O2/c1-3-27-11-10-25-14-20-17(16-6-4-5-7-19(16)26-20)13-18(25)21(27)12-15-8-9-22(29-2)24(28)23(15)25/h4-9,18,21,26,28H,3,10-14H2,1-2H3/t18-,21+,25-/m0/s1 |
| InChIKey | FMNRIXJRUJNSBN-HCYUJWNOSA-N |
| XLogP | 4.19 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|