About 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide
4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide (PubChem CID 10524370) has the molecular formula C19H13F2NO4S
and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide |
| PubChem CID | 10524370 |
| Molecular Formula | C19H13F2NO4S |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cc(F)c(F)cc2-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H13F2NO4S/c20-16-8-14(11-1-4-13(5-2-11)27(22,23)24)15(9-17(16)21)12-3-6-18-19(7-12)26-10-25-18/h1-9H,10H2,(H2,22,23,24) |
| InChIKey | FJQRBWIOLPBVTA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide?
The IUPAC name of 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide (CID 10524370) is 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide?
The canonical SMILES for 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide is NS(=O)(=O)c1ccc(-c2cc(F)c(F)cc2-c2ccc3c(c2)OCO3)cc1.
What is the InChIKey of 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide?
The InChIKey is FJQRBWIOLPBVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2NO4S/c20-16-8-14(11-1-4-13(5-2-11)27(22,23)24)15(9-17(16)21)12-3-6-18-19(7-12)26-10-25-18/h1-9H,10H2,(H2,22,23,24).
What are the key properties of 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide?
4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide has a molecular weight of 389.38 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-benzodioxol-5-yl)-4,5-difluorophenyl]benzenesulfonamide is sourced from PubChem (CID 10524370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).