C10H19N5O — CID 105244278
[(4-methylmorpholin-2-yl)-(2-methylpyrazol-3-yl)methyl]hydrazine (PubChem CID 105244278) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is [(4-methylmorpholin-2-yl)-(2-methylpyrazol-3-yl)methyl]hydrazine.
| Compound Name | [(4-methylmorpholin-2-yl)-(2-methylpyrazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105244278 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | [(4-methylmorpholin-2-yl)-(2-methylpyrazol-3-yl)methyl]hydrazine |
| SMILES | CN1CCOC(C(NN)c2ccnn2C)C1 |
| InChI | InChI=1S/C10H19N5O/c1-14-5-6-16-9(7-14)10(13-11)8-3-4-12-15(8)2/h3-4,9-10,13H,5-7,11H2,1-2H3 |
| InChIKey | PQAWYWCSWBYPSI-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|