C11H18FN3 — CID 105244646
3-(3-fluorophenyl)-2-hydrazinyl-N,N-dimethylpropan-1-amine (PubChem CID 105244646) has the molecular formula C11H18FN3 and a molecular weight of 211.28 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-hydrazinyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-2-hydrazinyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 105244646 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 3-(3-fluorophenyl)-2-hydrazinyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC(Cc1cccc(F)c1)NN |
| InChI | InChI=1S/C11H18FN3/c1-15(2)8-11(14-13)7-9-4-3-5-10(12)6-9/h3-6,11,14H,7-8,13H2,1-2H3 |
| InChIKey | LZTOASDVTRTRRV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|