C14H29N3O — CID 105245075
[1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-3-methylhexyl]hydrazine (PubChem CID 105245075) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is [1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-3-methylhexyl]hydrazine.
| Compound Name | [1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-3-methylhexyl]hydrazine |
|---|---|
| PubChem CID | 105245075 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | [1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-3-methylhexyl]hydrazine |
| SMILES | CCCC(C)CC(NN)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H29N3O/c1-3-5-11(2)8-13(16-15)14-9-17-7-4-6-12(17)10-18-14/h11-14,16H,3-10,15H2,1-2H3 |
| InChIKey | CZDOKVNXLWTFGZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|