C21H28O7 — CID 10524551
[(1R,2S,3S,4R,8S)-2,4-diacetyloxy-7,10,10-trimethyl-5-oxo-3-tricyclo[6.3.0.03,6]undec-6-enyl]methyl acetate (PubChem CID 10524551) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(1R,2S,3S,4R,8S)-2,4-diacetyloxy-7,10,10-trimethyl-5-oxo-3-tricyclo[6.3.0.03,6]undec-6-enyl]methyl acetate.
| Compound Name | [(1R,2S,3S,4R,8S)-2,4-diacetyloxy-7,10,10-trimethyl-5-oxo-3-tricyclo[6.3.0.03,6]undec-6-enyl]methyl acetate |
|---|---|
| PubChem CID | 10524551 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(1R,2S,3S,4R,8S)-2,4-diacetyloxy-7,10,10-trimethyl-5-oxo-3-tricyclo[6.3.0.03,6]undec-6-enyl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C(=C(C)[C@H]3CC(C)(C)C[C@H]3[C@@H]1OC(C)=O)C(=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C21H28O7/c1-10-14-7-20(5,6)8-15(14)18(27-12(3)23)21(9-26-11(2)22)16(10)17(25)19(21)28-13(4)24/h14-15,18-19H,7-9H2,1-6H3/t14-,15-,18+,19+,21-/m1/s1 |
| InChIKey | VTLLLOFWVICTFH-QPZFVJPBSA-N |
| XLogP | 2.36 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|