C19H36N3+ — CID 10524605
(1S,4R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene (PubChem CID 10524605) has the molecular formula C19H36N3+ and a molecular weight of 306.52 g/mol. Its IUPAC name is (1S,4R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene.
| Compound Name | (1S,4R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
|---|---|
| PubChem CID | 10524605 |
| Molecular Formula | C19H36N3+ |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (1S,4R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
| SMILES | CCCCCCCCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](C)NC(=[N+]32)N1 |
| InChI | InChI=1S/C19H35N3/c1-3-4-5-6-7-8-9-10-16-14-18-12-11-17-13-15(2)20-19(21-16)22(17)18/h15-18H,3-14H2,1-2H3,(H,20,21)/p+1/t15-,16+,17+,18-/m0/s1 |
| InChIKey | JDTPCMYRORPQFP-MLHJIOFPSA-O |
| XLogP | 3.77 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|