C11H24N2O2 — CID 105246280
(1-cyclopentyl-2,2-diethoxyethyl)hydrazine (PubChem CID 105246280) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is (1-cyclopentyl-2,2-diethoxyethyl)hydrazine.
| Compound Name | (1-cyclopentyl-2,2-diethoxyethyl)hydrazine |
|---|---|
| PubChem CID | 105246280 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | (1-cyclopentyl-2,2-diethoxyethyl)hydrazine |
| SMILES | CCOC(OCC)C(NN)C1CCCC1 |
| InChI | InChI=1S/C11H24N2O2/c1-3-14-11(15-4-2)10(13-12)9-7-5-6-8-9/h9-11,13H,3-8,12H2,1-2H3 |
| InChIKey | QXBZOYVIRWQZGQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|