C14H23F6N3O3 — CID 10524722
2,2,2-trifluoro-N-[4-[2-hydroxypropyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]butyl]acetamide (PubChem CID 10524722) has the molecular formula C14H23F6N3O3 and a molecular weight of 395.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[2-hydroxypropyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]butyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[2-hydroxypropyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]butyl]acetamide |
|---|---|
| PubChem CID | 10524722 |
| Molecular Formula | C14H23F6N3O3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[2-hydroxypropyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]butyl]acetamide |
| SMILES | CC(O)CN(CCCCNC(=O)C(F)(F)F)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H23F6N3O3/c1-10(24)9-23(8-4-6-22-12(26)14(18,19)20)7-3-2-5-21-11(25)13(15,16)17/h10,24H,2-9H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | IQKNEIHDCBAUBU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|