About 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine
1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine (PubChem CID 105247279) has the molecular formula C11H24N4
and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine.
Molecular Properties
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine |
| PubChem CID | 105247279 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)C1CN(C)CCN1C |
| InChI | InChI=1S/C11H24N4/c1-4-5-6-10(13-12)11-9-14(2)7-8-15(11)3/h4,10-11,13H,1,5-9,12H2,2-3H3 |
| InChIKey | XEBRMKNCOHIEDK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine?
The IUPAC name of 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine (CID 105247279) is 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine.
What is the SMILES notation for 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine?
The canonical SMILES for 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine is C=CCCC(NN)C1CN(C)CCN1C.
What is the InChIKey of 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine?
The InChIKey is XEBRMKNCOHIEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N4/c1-4-5-6-10(13-12)11-9-14(2)7-8-15(11)3/h4,10-11,13H,1,5-9,12H2,2-3H3.
What are the key properties of 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine?
1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine has a molecular weight of 212.34 g/mol, XLogP of 0.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dimethylpiperazin-2-yl)pent-4-enylhydrazine is sourced from PubChem (CID 105247279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).