C12H10F3N3 — CID 105248376
[(3,4-difluorophenyl)-(5-fluoro-2-pyridinyl)methyl]hydrazine (PubChem CID 105248376) has the molecular formula C12H10F3N3 and a molecular weight of 253.23 g/mol. Its IUPAC name is [(3,4-difluorophenyl)-(5-fluoro-2-pyridinyl)methyl]hydrazine.
| Compound Name | [(3,4-difluorophenyl)-(5-fluoro-2-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105248376 |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | [(3,4-difluorophenyl)-(5-fluoro-2-pyridinyl)methyl]hydrazine |
| SMILES | NNC(c1ccc(F)c(F)c1)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H10F3N3/c13-8-2-4-11(17-6-8)12(18-16)7-1-3-9(14)10(15)5-7/h1-6,12,18H,16H2 |
| InChIKey | RVGUAHKDTXXJLC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|