C14H15Cl2N3O2 — CID 105248853
[(3,5-dichloro-2-pyridinyl)-(2,4-dimethoxyphenyl)methyl]hydrazine (PubChem CID 105248853) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is [(3,5-dichloro-2-pyridinyl)-(2,4-dimethoxyphenyl)methyl]hydrazine.
| Compound Name | [(3,5-dichloro-2-pyridinyl)-(2,4-dimethoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105248853 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | [(3,5-dichloro-2-pyridinyl)-(2,4-dimethoxyphenyl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)c2ncc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C14H15Cl2N3O2/c1-20-9-3-4-10(12(6-9)21-2)13(19-17)14-11(16)5-8(15)7-18-14/h3-7,13,19H,17H2,1-2H3 |
| InChIKey | SGAOZMUKNTZJIQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|