C12H17F3N2O — CID 105248935
[1-(4-ethoxyphenyl)-4,4,4-trifluorobutyl]hydrazine (PubChem CID 105248935) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-4,4,4-trifluorobutyl]hydrazine.
| Compound Name | [1-(4-ethoxyphenyl)-4,4,4-trifluorobutyl]hydrazine |
|---|---|
| PubChem CID | 105248935 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [1-(4-ethoxyphenyl)-4,4,4-trifluorobutyl]hydrazine |
| SMILES | CCOc1ccc(C(CCC(F)(F)F)NN)cc1 |
| InChI | InChI=1S/C12H17F3N2O/c1-2-18-10-5-3-9(4-6-10)11(17-16)7-8-12(13,14)15/h3-6,11,17H,2,7-8,16H2,1H3 |
| InChIKey | COUXTXQBWRUYPE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|