C10H17F3N4 — CID 105248947
[4,4,4-trifluoro-1-(1-propylpyrazol-4-yl)butyl]hydrazine (PubChem CID 105248947) has the molecular formula C10H17F3N4 and a molecular weight of 250.27 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(1-propylpyrazol-4-yl)butyl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(1-propylpyrazol-4-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105248947 |
| Molecular Formula | C10H17F3N4 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [4,4,4-trifluoro-1-(1-propylpyrazol-4-yl)butyl]hydrazine |
| SMILES | CCCn1cc(C(CCC(F)(F)F)NN)cn1 |
| InChI | InChI=1S/C10H17F3N4/c1-2-5-17-7-8(6-15-17)9(16-14)3-4-10(11,12)13/h6-7,9,16H,2-5,14H2,1H3 |
| InChIKey | ZVQDFLXWFWUHOZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|