C12H21F3N4 — CID 105249025
[1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-yl]hydrazine (PubChem CID 105249025) has the molecular formula C12H21F3N4 and a molecular weight of 278.32 g/mol. Its IUPAC name is [1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-yl]hydrazine.
| Compound Name | [1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105249025 |
| Molecular Formula | C12H21F3N4 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | [1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-yl]hydrazine |
| SMILES | CCC(C)n1ccc(CC(CCC(F)(F)F)NN)n1 |
| InChI | InChI=1S/C12H21F3N4/c1-3-9(2)19-7-5-11(18-19)8-10(17-16)4-6-12(13,14)15/h5,7,9-10,17H,3-4,6,8,16H2,1-2H3 |
| InChIKey | SMZQUIIMTNJCFU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|