About [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine
[1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine (PubChem CID 105249942) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine.
Molecular Properties
| Compound Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine |
| PubChem CID | 105249942 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine |
| SMILES | C=C(C)CCC(NN)C1CN2CCN1CC2 |
| InChI | InChI=1S/C12H24N4/c1-10(2)3-4-11(14-13)12-9-15-5-7-16(12)8-6-15/h11-12,14H,1,3-9,13H2,2H3 |
| InChIKey | JJSWYIBWZWWNRN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine?
The IUPAC name of [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine (CID 105249942) is [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine.
What is the SMILES notation for [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine?
The canonical SMILES for [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine is C=C(C)CCC(NN)C1CN2CCN1CC2.
What is the InChIKey of [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine?
The InChIKey is JJSWYIBWZWWNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4/c1-10(2)3-4-11(14-13)12-9-15-5-7-16(12)8-6-15/h11-12,14H,1,3-9,13H2,2H3.
What are the key properties of [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine?
[1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine has a molecular weight of 224.35 g/mol, XLogP of 0.17, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-4-methylpent-4-enyl]hydrazine is sourced from PubChem (CID 105249942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).