C14H13F4N3 — CID 105250235
[[2-fluoro-5-(trifluoromethyl)phenyl]-(5-methyl-3-pyridinyl)methyl]hydrazine (PubChem CID 105250235) has the molecular formula C14H13F4N3 and a molecular weight of 299.27 g/mol. Its IUPAC name is [[2-fluoro-5-(trifluoromethyl)phenyl]-(5-methyl-3-pyridinyl)methyl]hydrazine.
| Compound Name | [[2-fluoro-5-(trifluoromethyl)phenyl]-(5-methyl-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105250235 |
| Molecular Formula | C14H13F4N3 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [[2-fluoro-5-(trifluoromethyl)phenyl]-(5-methyl-3-pyridinyl)methyl]hydrazine |
| SMILES | Cc1cncc(C(NN)c2cc(C(F)(F)F)ccc2F)c1 |
| InChI | InChI=1S/C14H13F4N3/c1-8-4-9(7-20-6-8)13(21-19)11-5-10(14(16,17)18)2-3-12(11)15/h2-7,13,21H,19H2,1H3 |
| InChIKey | YUOYDTFUQTUCHH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|