C11H19N3O — CID 105250512
[1-(6-methoxy-3-pyridinyl)-3-methylbutan-2-yl]hydrazine (PubChem CID 105250512) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is [1-(6-methoxy-3-pyridinyl)-3-methylbutan-2-yl]hydrazine.
| Compound Name | [1-(6-methoxy-3-pyridinyl)-3-methylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105250512 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | [1-(6-methoxy-3-pyridinyl)-3-methylbutan-2-yl]hydrazine |
| SMILES | COc1ccc(CC(NN)C(C)C)cn1 |
| InChI | InChI=1S/C11H19N3O/c1-8(2)10(14-12)6-9-4-5-11(15-3)13-7-9/h4-5,7-8,10,14H,6,12H2,1-3H3 |
| InChIKey | OFPKNHKEVXEVEP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|