C14H15Br2N3O — CID 105251145
[2-(2-bromo-5-methoxyphenyl)-1-(5-bromo-3-pyridinyl)ethyl]hydrazine (PubChem CID 105251145) has the molecular formula C14H15Br2N3O and a molecular weight of 401.10 g/mol. Its IUPAC name is [2-(2-bromo-5-methoxyphenyl)-1-(5-bromo-3-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(2-bromo-5-methoxyphenyl)-1-(5-bromo-3-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105251145 |
| Molecular Formula | C14H15Br2N3O |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | [2-(2-bromo-5-methoxyphenyl)-1-(5-bromo-3-pyridinyl)ethyl]hydrazine |
| SMILES | COc1ccc(Br)c(CC(NN)c2cncc(Br)c2)c1 |
| InChI | InChI=1S/C14H15Br2N3O/c1-20-12-2-3-13(16)9(5-12)6-14(19-17)10-4-11(15)8-18-7-10/h2-5,7-8,14,19H,6,17H2,1H3 |
| InChIKey | HUKFEKIRLHGFAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|