C14H16BrN3O2 — CID 105251245
[(5-bromo-3-pyridinyl)-(3,5-dimethoxyphenyl)methyl]hydrazine (PubChem CID 105251245) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is [(5-bromo-3-pyridinyl)-(3,5-dimethoxyphenyl)methyl]hydrazine.
| Compound Name | [(5-bromo-3-pyridinyl)-(3,5-dimethoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105251245 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | [(5-bromo-3-pyridinyl)-(3,5-dimethoxyphenyl)methyl]hydrazine |
| SMILES | COc1cc(OC)cc(C(NN)c2cncc(Br)c2)c1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-19-12-4-9(5-13(6-12)20-2)14(18-16)10-3-11(15)8-17-7-10/h3-8,14,18H,16H2,1-2H3 |
| InChIKey | BWEOAIKFICHKOE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|