About 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid
2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid (PubChem CID 10525136) has the molecular formula C24H18O6
and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid |
| PubChem CID | 10525136 |
| Molecular Formula | C24H18O6 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CC(=O)C2c3cccc(O)c3C(=O)c3c(O)cccc32)cc1 |
| InChI | InChI=1S/C24H18O6/c25-17-5-1-3-15-21(16-4-2-6-18(26)23(16)24(30)22(15)17)19(27)11-13-7-9-14(10-8-13)12-20(28)29/h1-10,21,25-26H,11-12H2,(H,28,29) |
| InChIKey | HFZLUCWDRHZVDJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid?
The IUPAC name of 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid (CID 10525136) is 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid.
What is the SMILES notation for 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid?
The canonical SMILES for 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid is O=C(O)Cc1ccc(CC(=O)C2c3cccc(O)c3C(=O)c3c(O)cccc32)cc1.
What is the InChIKey of 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid?
The InChIKey is HFZLUCWDRHZVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O6/c25-17-5-1-3-15-21(16-4-2-6-18(26)23(16)24(30)22(15)17)19(27)11-13-7-9-14(10-8-13)12-20(28)29/h1-10,21,25-26H,11-12H2,(H,28,29).
What are the key properties of 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid?
2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid has a molecular weight of 402.40 g/mol, XLogP of 3.21, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(4,5-dihydroxy-10-oxo-9H-anthracen-9-yl)-2-oxoethyl]phenyl]acetic acid is sourced from PubChem (CID 10525136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).