C11H18ClN3 — CID 105252913
[1-(6-chloro-3-pyridinyl)-4-methylpentyl]hydrazine (PubChem CID 105252913) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is [1-(6-chloro-3-pyridinyl)-4-methylpentyl]hydrazine.
| Compound Name | [1-(6-chloro-3-pyridinyl)-4-methylpentyl]hydrazine |
|---|---|
| PubChem CID | 105252913 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | [1-(6-chloro-3-pyridinyl)-4-methylpentyl]hydrazine |
| SMILES | CC(C)CCC(NN)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H18ClN3/c1-8(2)3-5-10(15-13)9-4-6-11(12)14-7-9/h4,6-8,10,15H,3,5,13H2,1-2H3 |
| InChIKey | MSHKXBBVMGLPGW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|