C11H14ClN5O — CID 105253115
[(6-chloro-3-pyridinyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine (PubChem CID 105253115) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is [(6-chloro-3-pyridinyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(6-chloro-3-pyridinyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105253115 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [(6-chloro-3-pyridinyl)-(4-methoxy-1-methylpyrazol-5-yl)methyl]hydrazine |
| SMILES | COc1cnn(C)c1C(NN)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H14ClN5O/c1-17-11(8(18-2)6-15-17)10(16-13)7-3-4-9(12)14-5-7/h3-6,10,16H,13H2,1-2H3 |
| InChIKey | FOUMLKSDUHEIBW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|