C10H16N4 — CID 105253393
3-[hydrazinyl-(1-methylcyclopropyl)methyl]pyridin-2-amine (PubChem CID 105253393) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 3-[hydrazinyl-(1-methylcyclopropyl)methyl]pyridin-2-amine.
| Compound Name | 3-[hydrazinyl-(1-methylcyclopropyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105253393 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 3-[hydrazinyl-(1-methylcyclopropyl)methyl]pyridin-2-amine |
| SMILES | CC1(C(NN)c2cccnc2N)CC1 |
| InChI | InChI=1S/C10H16N4/c1-10(4-5-10)8(14-12)7-3-2-6-13-9(7)11/h2-3,6,8,14H,4-5,12H2,1H3,(H2,11,13) |
| InChIKey | ZZPKBINTFPZBNK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|