C13H20N2 — CID 105254156
[2-cyclopropyl-1-(3,4-dimethylphenyl)ethyl]hydrazine (PubChem CID 105254156) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is [2-cyclopropyl-1-(3,4-dimethylphenyl)ethyl]hydrazine.
| Compound Name | [2-cyclopropyl-1-(3,4-dimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105254156 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [2-cyclopropyl-1-(3,4-dimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(C(CC2CC2)NN)cc1C |
| InChI | InChI=1S/C13H20N2/c1-9-3-6-12(7-10(9)2)13(15-14)8-11-4-5-11/h3,6-7,11,13,15H,4-5,8,14H2,1-2H3 |
| InChIKey | QFUJUIZRORYBMI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|