C25H46O2Si — CID 10525423
(4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde (PubChem CID 10525423) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is (4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | (4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 10525423 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (4aS,5R,6R,8aS)-5,6,8a-trimethyl-5-[2-tri(propan-2-yl)silyloxyethyl]-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
| SMILES | CC(C)[Si](OCC[C@]1(C)[C@H](C)CC[C@]2(C)C(C=O)=CCC[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H46O2Si/c1-18(2)28(19(3)4,20(5)6)27-16-15-24(8)21(7)13-14-25(9)22(17-26)11-10-12-23(24)25/h11,17-21,23H,10,12-16H2,1-9H3/t21-,23+,24-,25-/m1/s1 |
| InChIKey | ZEARCIUSCXDOPL-RVFVQDDPSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|