C24H17N5O2 — CID 10525448
(7S)-15-ethynyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one (PubChem CID 10525448) has the molecular formula C24H17N5O2 and a molecular weight of 407.43 g/mol. Its IUPAC name is (7S)-15-ethynyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one.
| Compound Name | (7S)-15-ethynyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one |
|---|---|
| PubChem CID | 10525448 |
| Molecular Formula | C24H17N5O2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (7S)-15-ethynyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one |
| SMILES | C#Cc1ccc2c(c1)C(=O)N1CCC[C@H]1c1c(-c3nc(-c4ccccc4)no3)ncn1-2 |
| InChI | InChI=1S/C24H17N5O2/c1-2-15-10-11-18-17(13-15)24(30)28-12-6-9-19(28)21-20(25-14-29(18)21)23-26-22(27-31-23)16-7-4-3-5-8-16/h1,3-5,7-8,10-11,13-14,19H,6,9,12H2/t19-/m0/s1 |
| InChIKey | LIDMLLUUCAACPY-IBGZPJMESA-N |
| XLogP | 3.86 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|