C24H28N2O4 — CID 10525520
methyl (2E,4Z)-5-[(3S,4S,6R)-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]penta-2,4-dienoate (PubChem CID 10525520) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is methyl (2E,4Z)-5-[(3S,4S,6R)-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]penta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-5-[(3S,4S,6R)-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 10525520 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl (2E,4Z)-5-[(3S,4S,6R)-6-[(S)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C\[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C24H28N2O4/c1-29-18-7-8-21-20(14-18)19(9-11-25-21)24(28)22-13-16-10-12-26(22)15-17(16)5-3-4-6-23(27)30-2/h3-9,11,14,16-17,22,24,28H,10,12-13,15H2,1-2H3/b5-3-,6-4+/t16-,17-,22+,24-/m0/s1 |
| InChIKey | FEWLIEIHWZNOIX-FQHCRDNSSA-N |
| XLogP | 3.27 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|