C13H19ClN2OS — CID 105255698
[(4-chloro-3-methoxyphenyl)-(thian-2-yl)methyl]hydrazine (PubChem CID 105255698) has the molecular formula C13H19ClN2OS and a molecular weight of 286.83 g/mol. Its IUPAC name is [(4-chloro-3-methoxyphenyl)-(thian-2-yl)methyl]hydrazine.
| Compound Name | [(4-chloro-3-methoxyphenyl)-(thian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105255698 |
| Molecular Formula | C13H19ClN2OS |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(4-chloro-3-methoxyphenyl)-(thian-2-yl)methyl]hydrazine |
| SMILES | COc1cc(C(NN)C2CCCCS2)ccc1Cl |
| InChI | InChI=1S/C13H19ClN2OS/c1-17-11-8-9(5-6-10(11)14)13(16-15)12-4-2-3-7-18-12/h5-6,8,12-13,16H,2-4,7,15H2,1H3 |
| InChIKey | WLKWLRNMCJNVRE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|