C22H21NO7 — CID 10525666
(5R,9aR)-5-(3,4,5-trimethoxyphenyl)-5,8,9,9a-tetrahydro-[1,3]benzodioxolo[6,5-f]indolizine-7,10-dione (PubChem CID 10525666) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is (5R,9aR)-5-(3,4,5-trimethoxyphenyl)-5,8,9,9a-tetrahydro-[1,3]benzodioxolo[6,5-f]indolizine-7,10-dione.
| Compound Name | (5R,9aR)-5-(3,4,5-trimethoxyphenyl)-5,8,9,9a-tetrahydro-[1,3]benzodioxolo[6,5-f]indolizine-7,10-dione |
|---|---|
| PubChem CID | 10525666 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (5R,9aR)-5-(3,4,5-trimethoxyphenyl)-5,8,9,9a-tetrahydro-[1,3]benzodioxolo[6,5-f]indolizine-7,10-dione |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C(=O)[C@H]3CCC(=O)N23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C22H21NO7/c1-26-17-6-11(7-18(27-2)22(17)28-3)20-12-8-15-16(30-10-29-15)9-13(12)21(25)14-4-5-19(24)23(14)20/h6-9,14,20H,4-5,10H2,1-3H3/t14-,20-/m1/s1 |
| InChIKey | PAIDISJCGAARKO-JLTOFOAXSA-N |
| XLogP | 2.72 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |