About 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile
5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile (PubChem CID 10525695) has the molecular formula C27H29N3O
and a molecular weight of 411.55 g/mol. Its IUPAC name is 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile.
Molecular Properties
| Compound Name | 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile |
| PubChem CID | 10525695 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile |
| SMILES | N#CC(CCCN1CCC(O)(c2ccccn2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O/c28-22-26(23-10-3-1-4-11-23,24-12-5-2-6-13-24)15-9-19-30-20-16-27(31,17-21-30)25-14-7-8-18-29-25/h1-8,10-14,18,31H,9,15-17,19-21H2 |
| InChIKey | NHNHEWYPECEYCE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile?
The IUPAC name of 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile (CID 10525695) is 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile.
What is the SMILES notation for 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile?
The canonical SMILES for 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile is N#CC(CCCN1CCC(O)(c2ccccn2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile?
The InChIKey is NHNHEWYPECEYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29N3O/c28-22-26(23-10-3-1-4-11-23,24-12-5-2-6-13-24)15-9-19-30-20-16-27(31,17-21-30)25-14-7-8-18-29-25/h1-8,10-14,18,31H,9,15-17,19-21H2.
What are the key properties of 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile?
5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile has a molecular weight of 411.55 g/mol, XLogP of 4.66, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2,2-diphenylpentanenitrile is sourced from PubChem (CID 10525695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).