C13H12BrClFN3 — CID 105258636
[2-(4-bromo-2-chlorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine (PubChem CID 105258636) has the molecular formula C13H12BrClFN3 and a molecular weight of 344.62 g/mol. Its IUPAC name is [2-(4-bromo-2-chlorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-2-chlorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105258636 |
| Molecular Formula | C13H12BrClFN3 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | [2-(4-bromo-2-chlorophenyl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)cc1Cl)c1ccncc1F |
| InChI | InChI=1S/C13H12BrClFN3/c14-9-2-1-8(11(15)6-9)5-13(19-17)10-3-4-18-7-12(10)16/h1-4,6-7,13,19H,5,17H2 |
| InChIKey | IZQYGAMWULSECF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|