C9H17F3N2O2S — CID 105258853
[1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentyl]hydrazine (PubChem CID 105258853) has the molecular formula C9H17F3N2O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentyl]hydrazine.
| Compound Name | [1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentyl]hydrazine |
|---|---|
| PubChem CID | 105258853 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentyl]hydrazine |
| SMILES | NNC(CCCC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17F3N2O2S/c10-9(11,12)4-1-2-8(14-13)7-3-5-17(15,16)6-7/h7-8,14H,1-6,13H2 |
| InChIKey | QNKKYRVEUYYTLP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|