C13H29N3 — CID 105259229
3-(3-ethylcyclohexyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine (PubChem CID 105259229) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is 3-(3-ethylcyclohexyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-ethylcyclohexyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 105259229 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 3-(3-ethylcyclohexyl)-3-hydrazinyl-N,N-dimethylpropan-1-amine |
| SMILES | CCC1CCCC(C(CCN(C)C)NN)C1 |
| InChI | InChI=1S/C13H29N3/c1-4-11-6-5-7-12(10-11)13(15-14)8-9-16(2)3/h11-13,15H,4-10,14H2,1-3H3 |
| InChIKey | BLPPDXMXCJBEJI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|