C12H18F3N3 — CID 105259265
3-hydrazinyl-N,N-dimethyl-3-[2-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 105259265) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-hydrazinyl-N,N-dimethyl-3-[2-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 3-hydrazinyl-N,N-dimethyl-3-[2-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 105259265 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-hydrazinyl-N,N-dimethyl-3-[2-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CN(C)CCC(NN)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H18F3N3/c1-18(2)8-7-11(17-16)9-5-3-4-6-10(9)12(13,14)15/h3-6,11,17H,7-8,16H2,1-2H3 |
| InChIKey | BJPURFFSSOEHOO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|