C24H30N6O — CID 10526074
14-[2-(dimethylamino)ethyl]-10-(2-piperidin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one (PubChem CID 10526074) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 14-[2-(dimethylamino)ethyl]-10-(2-piperidin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one.
| Compound Name | 14-[2-(dimethylamino)ethyl]-10-(2-piperidin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one |
|---|---|
| PubChem CID | 10526074 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 14-[2-(dimethylamino)ethyl]-10-(2-piperidin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one |
| SMILES | CN(C)CCn1nc2c3c(c(NCCN4CCCCC4)ccc31)C(=O)c1ccncc1-2 |
| InChI | InChI=1S/C24H30N6O/c1-28(2)14-15-30-20-7-6-19(26-10-13-29-11-4-3-5-12-29)21-22(20)23(27-30)18-16-25-9-8-17(18)24(21)31/h6-9,16,26H,3-5,10-15H2,1-2H3 |
| InChIKey | LBCJCBWCXIEIJR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|