C15H16BrClN2 — CID 105261045
[(3-bromo-4-chlorophenyl)-(3,4-dimethylphenyl)methyl]hydrazine (PubChem CID 105261045) has the molecular formula C15H16BrClN2 and a molecular weight of 339.66 g/mol. Its IUPAC name is [(3-bromo-4-chlorophenyl)-(3,4-dimethylphenyl)methyl]hydrazine.
| Compound Name | [(3-bromo-4-chlorophenyl)-(3,4-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105261045 |
| Molecular Formula | C15H16BrClN2 |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [(3-bromo-4-chlorophenyl)-(3,4-dimethylphenyl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)c2ccc(Cl)c(Br)c2)cc1C |
| InChI | InChI=1S/C15H16BrClN2/c1-9-3-4-11(7-10(9)2)15(19-18)12-5-6-14(17)13(16)8-12/h3-8,15,19H,18H2,1-2H3 |
| InChIKey | SYGGTLMMWXGSHP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|