About 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol
4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol (PubChem CID 10526132) has the molecular formula C27H30ClNO
and a molecular weight of 420.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol |
| PubChem CID | 10526132 |
| Molecular Formula | C27H30ClNO |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CCN(CCCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30ClNO/c28-25-15-13-24(14-16-25)27(30)17-20-29(21-18-27)19-7-12-26(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,13-16,26,30H,7,12,17-21H2 |
| InChIKey | LLQCATMGHGFZSS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol?
The IUPAC name of 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol (CID 10526132) is 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol.
What is the SMILES notation for 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol?
The canonical SMILES for 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol is OC1(c2ccc(Cl)cc2)CCN(CCCC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol?
The InChIKey is LLQCATMGHGFZSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30ClNO/c28-25-15-13-24(14-16-25)27(30)17-20-29(21-18-27)19-7-12-26(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,13-16,26,30H,7,12,17-21H2.
What are the key properties of 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol?
4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol has a molecular weight of 420.00 g/mol, XLogP of 6.24, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-1-(4,4-diphenylbutyl)piperidin-4-ol is sourced from PubChem (CID 10526132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).