C12H19N3 — CID 105261976
[3-methylidene-1-(3-methyl-4-pyridinyl)pentyl]hydrazine (PubChem CID 105261976) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is [3-methylidene-1-(3-methyl-4-pyridinyl)pentyl]hydrazine.
| Compound Name | [3-methylidene-1-(3-methyl-4-pyridinyl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105261976 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | [3-methylidene-1-(3-methyl-4-pyridinyl)pentyl]hydrazine |
| SMILES | C=C(CC)CC(NN)c1ccncc1C |
| InChI | InChI=1S/C12H19N3/c1-4-9(2)7-12(15-13)11-5-6-14-8-10(11)3/h5-6,8,12,15H,2,4,7,13H2,1,3H3 |
| InChIKey | PLTOYFMAWGNFSM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|