C23H39N3O4 — CID 10526216
(2R)-N-tert-butyl-2-[[2-[(2S)-1-(cyclohexanecarbonyl)pyrrolidin-2-yl]-2-oxoacetyl]amino]-4-methylpentanamide (PubChem CID 10526216) has the molecular formula C23H39N3O4 and a molecular weight of 421.58 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-[[2-[(2S)-1-(cyclohexanecarbonyl)pyrrolidin-2-yl]-2-oxoacetyl]amino]-4-methylpentanamide.
| Compound Name | (2R)-N-tert-butyl-2-[[2-[(2S)-1-(cyclohexanecarbonyl)pyrrolidin-2-yl]-2-oxoacetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 10526216 |
| Molecular Formula | C23H39N3O4 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | (2R)-N-tert-butyl-2-[[2-[(2S)-1-(cyclohexanecarbonyl)pyrrolidin-2-yl]-2-oxoacetyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)C(=O)[C@@H]1CCCN1C(=O)C1CCCCC1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H39N3O4/c1-15(2)14-17(20(28)25-23(3,4)5)24-21(29)19(27)18-12-9-13-26(18)22(30)16-10-7-6-8-11-16/h15-18H,6-14H2,1-5H3,(H,24,29)(H,25,28)/t17-,18+/m1/s1 |
| InChIKey | TUKGFKWGKKMUHX-MSOLQXFVSA-N |
| XLogP | 2.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|