C14H19Cl5N2O2 — CID 10526365
(3Z,6S)-3-[(2S)-3,3-dichloro-2-methylpropylidene]-1,4-dimethyl-6-[(2S)-3,3,3-trichloro-2-methylpropyl]piperazine-2,5-dione (PubChem CID 10526365) has the molecular formula C14H19Cl5N2O2 and a molecular weight of 424.58 g/mol. Its IUPAC name is (3Z,6S)-3-[(2S)-3,3-dichloro-2-methylpropylidene]-1,4-dimethyl-6-[(2S)-3,3,3-trichloro-2-methylpropyl]piperazine-2,5-dione.
| Compound Name | (3Z,6S)-3-[(2S)-3,3-dichloro-2-methylpropylidene]-1,4-dimethyl-6-[(2S)-3,3,3-trichloro-2-methylpropyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10526365 |
| Molecular Formula | C14H19Cl5N2O2 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | (3Z,6S)-3-[(2S)-3,3-dichloro-2-methylpropylidene]-1,4-dimethyl-6-[(2S)-3,3,3-trichloro-2-methylpropyl]piperazine-2,5-dione |
| SMILES | C[C@@H](/C=C1/C(=O)N(C)[C@@H](C[C@H](C)C(Cl)(Cl)Cl)C(=O)N1C)C(Cl)Cl |
| InChI | InChI=1S/C14H19Cl5N2O2/c1-7(11(15)16)5-9-12(22)21(4)10(13(23)20(9)3)6-8(2)14(17,18)19/h5,7-8,10-11H,6H2,1-4H3/b9-5-/t7-,8-,10-/m0/s1 |
| InChIKey | VNDCRMHOOMVIFT-YQDKCZNOSA-N |
| XLogP | 4.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|