C24H31N3O4 — CID 10526419
N-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-2-amino-4,5-dimethoxybenzamide (PubChem CID 10526419) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-2-amino-4,5-dimethoxybenzamide.
| Compound Name | N-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-2-amino-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 10526419 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-2-amino-4,5-dimethoxybenzamide |
| SMILES | COc1cc(N)c(C(=O)NCCN2C[C@@H]3CCc4c(OC)cccc4[C@@H]3C2)cc1OC |
| InChI | InChI=1S/C24H31N3O4/c1-29-21-6-4-5-16-17(21)8-7-15-13-27(14-19(15)16)10-9-26-24(28)18-11-22(30-2)23(31-3)12-20(18)25/h4-6,11-12,15,19H,7-10,13-14,25H2,1-3H3,(H,26,28)/t15-,19+/m0/s1 |
| InChIKey | RLJXOVFXQJQZMU-HNAYVOBHSA-N |
| XLogP | 2.69 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|