About 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane
5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane (PubChem CID 10526446) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane.
Molecular Properties
| Compound Name | 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane |
| PubChem CID | 10526446 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane |
| SMILES | CN1CCCN2CCCN(CCC1)C2 |
| InChI | InChI=1S/C11H23N3/c1-12-5-2-7-13-9-4-10-14(11-13)8-3-6-12/h2-11H2,1H3 |
| InChIKey | ORFFPHDVDIVKQQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane?
The IUPAC name of 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane (CID 10526446) is 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane.
What is the SMILES notation for 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane?
The canonical SMILES for 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane is CN1CCCN2CCCN(CCC1)C2.
What is the InChIKey of 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane?
The InChIKey is ORFFPHDVDIVKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-12-5-2-7-13-9-4-10-14(11-13)8-3-6-12/h2-11H2,1H3.
What are the key properties of 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane?
5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane has a molecular weight of 197.33 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,5,9-triazabicyclo[7.3.1]tridecane is sourced from PubChem (CID 10526446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).