About [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine
[2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine (PubChem CID 105265048) has the molecular formula C7H14F2N2O
and a molecular weight of 180.20 g/mol. Its IUPAC name is [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine.
Molecular Properties
| Compound Name | [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine |
| PubChem CID | 105265048 |
| Molecular Formula | C7H14F2N2O |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine |
| SMILES | NNC(C(F)F)C1CCOCC1 |
| InChI | InChI=1S/C7H14F2N2O/c8-7(9)6(11-10)5-1-3-12-4-2-5/h5-7,11H,1-4,10H2 |
| InChIKey | OMHDBFCXMLMSDF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine?
The IUPAC name of [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine (CID 105265048) is [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine.
What is the SMILES notation for [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine?
The canonical SMILES for [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine is NNC(C(F)F)C1CCOCC1.
What is the InChIKey of [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine?
The InChIKey is OMHDBFCXMLMSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2N2O/c8-7(9)6(11-10)5-1-3-12-4-2-5/h5-7,11H,1-4,10H2.
What are the key properties of [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine?
[2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine has a molecular weight of 180.20 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-1-(oxan-4-yl)ethyl]hydrazine is sourced from PubChem (CID 105265048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).