C6H7ClF2N2S — CID 105265155
[1-(5-chlorothiophen-2-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 105265155) has the molecular formula C6H7ClF2N2S and a molecular weight of 212.65 g/mol. Its IUPAC name is [1-(5-chlorothiophen-2-yl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(5-chlorothiophen-2-yl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105265155 |
| Molecular Formula | C6H7ClF2N2S |
| Molecular Weight | 212.65 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | [1-(5-chlorothiophen-2-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(c1ccc(Cl)s1)C(F)F |
| InChI | InChI=1S/C6H7ClF2N2S/c7-4-2-1-3(12-4)5(11-10)6(8)9/h1-2,5-6,11H,10H2 |
| InChIKey | SCQWBIDEKMYUHC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.65 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|